Information card for entry 2234798
| Common name |
All-cis-4,6-diamino-cyclohexane-1,2,3-triol dihydrochloride |
| Chemical name |
1,3-diammonio-1,2,3-trideoxy-<i>cis</i>-inositol dichloride |
| Formula |
C6 H16 Cl2 N2 O3 |
| Calculated formula |
C6 H16 Cl2 N2 O3 |
| SMILES |
[NH3+][C@H]1[C@@H](O)C(O)[C@@H](O)[C@@H]([NH3+])C1.[Cl-].[Cl-] |
| Title of publication |
Redetermination of 1,3-diammonio-1,2,3-trideoxy-<i>cis</i>-inositol dichloride |
| Authors of publication |
Neis, Christian; Merten, Günter J.; Altenhofer, Philipp; Hegetschweiler, Kaspar |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
5 |
| Pages of publication |
o1411 - o1412 |
| a |
7.7899 ± 0.0004 Å |
| b |
10.1254 ± 0.0005 Å |
| c |
13.0136 ± 0.0007 Å |
| α |
90° |
| β |
91.156 ± 0.002° |
| γ |
90° |
| Cell volume |
1026.25 ± 0.09 Å3 |
| Cell temperature |
130 ± 2 K |
| Ambient diffraction temperature |
130 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.0176 |
| Residual factor for significantly intense reflections |
0.0174 |
| Weighted residual factors for significantly intense reflections |
0.0471 |
| Weighted residual factors for all reflections included in the refinement |
0.0473 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.059 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2234798.html