Information card for entry 2235144
| Chemical name |
<i>N</i>,<i>N</i>'-Bis(4-methylphenyl)-<i>N</i>''-(2,2,2- trichloroacetyl)phosphoric triamide |
| Formula |
C16 H17 Cl3 N3 O2 P |
| Calculated formula |
C16 H17 Cl3 N3 O2 P |
| SMILES |
ClC(Cl)(Cl)C(=O)NP(=O)(Nc1ccc(cc1)C)Nc1ccc(cc1)C |
| Title of publication |
<i>N</i>,<i>N</i>'-Bis(4-methylphenyl)-<i>N</i>''-(2,2,2-trichloroacetyl)phosphoric triamide |
| Authors of publication |
Raissi Shabari, Akbar; Pourayoubi, Mehrdad; Fadaei, Hassan; Nečas, Marek; Babiak, Michal |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
6 |
| Pages of publication |
o1813 |
| a |
17.5151 ± 0.0006 Å |
| b |
10.8638 ± 0.0004 Å |
| c |
9.8615 ± 0.0003 Å |
| α |
90° |
| β |
97.565 ± 0.003° |
| γ |
90° |
| Cell volume |
1860.12 ± 0.11 Å3 |
| Cell temperature |
120 ± 2 K |
| Ambient diffraction temperature |
120 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0344 |
| Residual factor for significantly intense reflections |
0.0278 |
| Weighted residual factors for significantly intense reflections |
0.0698 |
| Weighted residual factors for all reflections included in the refinement |
0.0717 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.04 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2235144.html