Information card for entry 2235402
| Chemical name |
[(3<i>R</i>*,4<i>R</i>*,5<i>R</i>*)-2,3-Diphenylisoxazolidine-4,5- diyl]dimethanol |
| Formula |
C17 H19 N O3 |
| Calculated formula |
C17 H19 N O3 |
| SMILES |
c1(ccccc1)N1[C@@H](c2ccccc2)[C@@H]([C@H](CO)O1)CO.c1(ccccc1)N1[C@H](c2ccccc2)[C@H]([C@@H](CO)O1)CO |
| Title of publication |
[(3<i>R</i>*,4<i>R</i>*,5<i>R</i>*)-2,3-Diphenylisoxazolidine-4,5-diyl]dimethanol |
| Authors of publication |
Guner, Selahaddin; Şeftalicioglu, Kubra |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
7 |
| Pages of publication |
o2061 |
| a |
8.1254 ± 0.0002 Å |
| b |
11.0602 ± 0.0002 Å |
| c |
32.4813 ± 0.001 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2919.05 ± 0.13 Å3 |
| Cell temperature |
296 K |
| Ambient diffraction temperature |
296 K |
| Number of distinct elements |
4 |
| Space group number |
61 |
| Hermann-Mauguin space group symbol |
P b c a |
| Hall space group symbol |
-P 2ac 2ab |
| Residual factor for all reflections |
0.0885 |
| Residual factor for significantly intense reflections |
0.0558 |
| Weighted residual factors for significantly intense reflections |
0.0985 |
| Weighted residual factors for all reflections included in the refinement |
0.108 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.118 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2235402.html