Information card for entry 2235602
| Chemical name |
[6,13-Bis(2,4-dichlorobenzoyl)-5,7,12,14- tetramethyldibenzo[<i>b</i>,<i>i</i>][1,4,8,11]tetraazacyclotetradecinato- κ^4^<i>N</i>]nickel(II) acetone monosolvate |
| Formula |
C39 H32 Cl4 N4 Ni O3 |
| Calculated formula |
C39 H32 Cl4 N4 Ni O3 |
| SMILES |
[Ni]123N4c5c([N]1=C(C(C(=O)c1ccc(Cl)cc1Cl)=C(N3c1c([N]2=C(C(=C4C)C(=O)c2c(Cl)cc(Cl)cc2)C)cccc1)C)C)cccc5.O=C(C)C |
| Title of publication |
[6,13-Bis(2,4-dichlorobenzoyl)-5,7,12,14-tetramethyldibenzo[<i>b</i>,<i>i</i>][1,4,8,11]tetraazacyclotetradecinato- κ^4^<i>N</i>]nickel(II) acetone monosolvate |
| Authors of publication |
Jiang, Bo-Kun; Shen, Xuan; Wang, Xin; Su, Fan; Zhu, Dun-Ru |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
7 |
| Pages of publication |
m871 |
| a |
11.546 ± 0.003 Å |
| b |
27.134 ± 0.007 Å |
| c |
12.149 ± 0.003 Å |
| α |
90° |
| β |
110.372 ± 0.004° |
| γ |
90° |
| Cell volume |
3568.1 ± 1.6 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.2085 |
| Residual factor for significantly intense reflections |
0.0776 |
| Weighted residual factors for significantly intense reflections |
0.1413 |
| Weighted residual factors for all reflections included in the refinement |
0.1899 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.039 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2235602.html