Information card for entry 2235631
| Chemical name |
Aqua{4,4',6,6'-tetrachloro-2,2'-[(2,2-dimethylpropane-1,3-diyl)bis(nitrilomethanylylidene)]diphenolato}zinc |
| Formula |
C19 H18 Cl4 N2 O3 Zn |
| Calculated formula |
C19 H18 Cl4 N2 O3 Zn |
| SMILES |
c12c(cc(cc1C=[N]1CC(C)(C)C[N]3=Cc4cc(cc(c4O[Zn]13(O2)[OH2])Cl)Cl)Cl)Cl |
| Title of publication |
Aqua{4,4',6,6'-tetrachloro-2,2'-[(2,2-dimethylpropane-1,3-diyl)bis(nitrilomethanylylidene)]diphenolato}zinc |
| Authors of publication |
Kargar, Hadi; Kia, Reza; Abbasian, Saeideh; Tahir, Muhammad Nawaz |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
7 |
| Pages of publication |
m936 - m937 |
| a |
11.2812 ± 0.0007 Å |
| b |
22.5897 ± 0.0015 Å |
| c |
17.6777 ± 0.0012 Å |
| α |
90° |
| β |
107.159 ± 0.003° |
| γ |
90° |
| Cell volume |
4304.4 ± 0.5 Å3 |
| Cell temperature |
291 ± 2 K |
| Ambient diffraction temperature |
291 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0989 |
| Residual factor for significantly intense reflections |
0.0467 |
| Weighted residual factors for significantly intense reflections |
0.0791 |
| Weighted residual factors for all reflections included in the refinement |
0.094 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2235631.html