Information card for entry 2235709
| Common name |
L3 |
| Chemical name |
1,6-Bis[(2,2':6',2''-terpyridin-4'-yl)oxy]hexane |
| Formula |
C36 H32 N6 O2 |
| Calculated formula |
C36 H32 N6 O2 |
| SMILES |
C(CCOc1cc(nc(c1)c1ccccn1)c1ccccn1)CCCOc1cc(nc(c1)c1ccccn1)c1ccccn1 |
| Title of publication |
1,6-Bis[(2,2':6',2''-terpyridin-4'-yl)oxy]hexane |
| Authors of publication |
Nikolayenko, Varvara I.; Akerman, Matthew P.; Grimmer, Craig D.; Reddy, Desigan |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
7 |
| Pages of publication |
o2272 - o2273 |
| a |
15.139 ± 0.005 Å |
| b |
11.428 ± 0.005 Å |
| c |
16.76 ± 0.005 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2899.6 ± 1.8 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
61 |
| Hermann-Mauguin space group symbol |
P b c a |
| Hall space group symbol |
-P 2ac 2ab |
| Residual factor for all reflections |
0.0572 |
| Residual factor for significantly intense reflections |
0.038 |
| Weighted residual factors for significantly intense reflections |
0.0951 |
| Weighted residual factors for all reflections included in the refinement |
0.0995 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.944 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2235709.html