Information card for entry 2235882
| Chemical name |
2,3,5-Triphenyl-2<i>H</i>-tetrazol-3-ium tetraphenylborate |
| Formula |
C43 H35 B N4 |
| Calculated formula |
C43 H35 B N4 |
| SMILES |
[B-](c1ccccc1)(c1ccccc1)(c1ccccc1)c1ccccc1.n1n([n+](nc1c1ccccc1)c1ccccc1)c1ccccc1 |
| Title of publication |
2,3,5-Triphenyl-2<i>H</i>-tetrazol-3-ium tetraphenylborate |
| Authors of publication |
Fun, Hoong-Kun; Chia, Tze Shyang; Mostafa, Gamal A. E.; Hefnawy, Mohamed M.; Abdel-Aziz, Hatem A. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
8 |
| Pages of publication |
o2567 |
| a |
9.8809 ± 0.0001 Å |
| b |
22.6572 ± 0.0003 Å |
| c |
16.009 ± 0.0002 Å |
| α |
90° |
| β |
110.441 ± 0.001° |
| γ |
90° |
| Cell volume |
3358.32 ± 0.07 Å3 |
| Cell temperature |
100 ± 1 K |
| Ambient diffraction temperature |
100 ± 1 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0697 |
| Residual factor for significantly intense reflections |
0.0497 |
| Weighted residual factors for significantly intense reflections |
0.1099 |
| Weighted residual factors for all reflections included in the refinement |
0.1206 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.03 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2235882.html