Information card for entry 2236080
| Chemical name |
<i>N</i>,<i>N</i>,<i>N</i>',<i>N</i>'-Tetramethylphthalamide |
| Formula |
C12 H16 N2 O2 |
| Calculated formula |
C12 H16 N2 O2 |
| SMILES |
O=C(N(C)C)c1ccccc1C(=O)N(C)C |
| Title of publication |
<i>N</i>,<i>N</i>,<i>N</i>',<i>N</i>'-Tetramethylphthalamide |
| Authors of publication |
Hamada, Adel; Boudinar, Yamina; Beghidja, Adel; Boutebdja, Mehdi |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
9 |
| Pages of publication |
o2710 |
| a |
6.7337 ± 0.0006 Å |
| b |
18.123 ± 0.0014 Å |
| c |
9.8216 ± 0.0008 Å |
| α |
90° |
| β |
104.918 ± 0.003° |
| γ |
90° |
| Cell volume |
1158.18 ± 0.17 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.0552 |
| Residual factor for significantly intense reflections |
0.0488 |
| Weighted residual factors for significantly intense reflections |
0.1183 |
| Weighted residual factors for all reflections included in the refinement |
0.1235 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.057 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2236080.html