Information card for entry 2236124
| Chemical name |
(<i>E</i>)-1-(5-Iodothiophen-2-yl)-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
| Formula |
C16 H15 I O4 S |
| Calculated formula |
C16 H15 I O4 S |
| SMILES |
Ic1sc(cc1)C(=O)/C=C/c1cc(OC)c(OC)c(OC)c1 |
| Title of publication |
(<i>E</i>)-1-(5-Iodothiophen-2-yl)-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
| Authors of publication |
Viswanathan, Vijayan; Srinivasan, Thothadri; Thirunarayanan, Ayyavu; Rajakumar, Perumal; Velmurugan, Devadasan |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
10 |
| Pages of publication |
o2921 |
| a |
17.2328 ± 0.0012 Å |
| b |
8.1885 ± 0.0006 Å |
| c |
23.7049 ± 0.0017 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
3345 ± 0.4 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
61 |
| Hermann-Mauguin space group symbol |
P b c a |
| Hall space group symbol |
-P 2ac 2ab |
| Residual factor for all reflections |
0.0369 |
| Residual factor for significantly intense reflections |
0.0252 |
| Weighted residual factors for significantly intense reflections |
0.0576 |
| Weighted residual factors for all reflections included in the refinement |
0.0622 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.063 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2236124.html