Information card for entry 2236262
| Chemical name |
<i>N</i>-(1,5-Dimethyl-3-oxo-2-phenyl-2,3-dihydro-1<i>H</i>-pyrazol-4-yl)- 2-[4-(methylsulfanyl)phenyl]acetamide |
| Formula |
C20 H21 N3 O2 S |
| Calculated formula |
C20 H21 N3 O2 S |
| SMILES |
S(c1ccc(cc1)CC(=O)Nc1c(n(n(c1=O)c1ccccc1)C)C)C |
| Title of publication |
<i>N</i>-(1,5-Dimethyl-3-oxo-2-phenyl-2,3-dihydro-1<i>H</i>-pyrazol-4-yl)-2-[4-(methylsulfanyl)phenyl]acetamide |
| Authors of publication |
Fun, Hoong-Kun; Quah, Ching Kheng; Nayak, Prakash S.; Narayana, B.; Sarojini, B. K. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
9 |
| Pages of publication |
o2677 |
| a |
14.9176 ± 0.0008 Å |
| b |
6.6527 ± 0.0004 Å |
| c |
19.5792 ± 0.001 Å |
| α |
90° |
| β |
110.689 ± 0.001° |
| γ |
90° |
| Cell volume |
1817.78 ± 0.17 Å3 |
| Cell temperature |
100 K |
| Ambient diffraction temperature |
100 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.055 |
| Residual factor for significantly intense reflections |
0.0416 |
| Weighted residual factors for significantly intense reflections |
0.1066 |
| Weighted residual factors for all reflections included in the refinement |
0.1158 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.034 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2236262.html