Information card for entry 2236283
| Chemical name |
Tetramethyl 1,4-dimethyl-13,14-dioxapentacyclo[8.2.1.1^4,7^.0^2,9^.0^3,8^]tetradeca- 5,11-diene-5,6,11,12-tetracarboxylate |
| Formula |
C22 H24 O10 |
| Calculated formula |
C22 H24 O10 |
| SMILES |
COC(C1[C@@H]2O[C@](C=1C(OC)=O)([C@@H]1[C@H]2[C@H]2[C@@H]3C(C(=O)OC)=C([C@]([C@@H]12)(O3)C)C(OC)=O)C)=O.COC(C1[C@H]2O[C@@](C=1C(OC)=O)([C@H]1[C@@H]2[C@@H]2[C@H]3C(C(=O)OC)=C([C@@]([C@H]12)(O3)C)C(OC)=O)C)=O |
| Title of publication |
Tetramethyl 1,4-dimethyl-13,14-dioxapentacyclo[8.2.1.1^4,7^.0^2,9^.0^3,8^]tetradeca-5,11-diene-5,6,11,12-tetracarboxylate |
| Authors of publication |
Lough, Alan J.; Jack, Kelsey; Tam, William |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
10 |
| Pages of publication |
o2961 |
| a |
11.517 ± 0.0014 Å |
| b |
13.9586 ± 0.0015 Å |
| c |
26.413 ± 0.003 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
4246.2 ± 0.8 Å3 |
| Cell temperature |
147 ± 2 K |
| Ambient diffraction temperature |
147 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
61 |
| Hermann-Mauguin space group symbol |
P b c a |
| Hall space group symbol |
-P 2ac 2ab |
| Residual factor for all reflections |
0.0799 |
| Residual factor for significantly intense reflections |
0.0415 |
| Weighted residual factors for significantly intense reflections |
0.0854 |
| Weighted residual factors for all reflections included in the refinement |
0.0957 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.895 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2236283.html