Information card for entry 2236586
| Chemical name |
7<i>H</i>-[1,2]Benzothiazolo[3,2-<i>b</i>]quinazoline 5,5-dioxide |
| Formula |
C14 H10 N2 O2 S |
| Calculated formula |
C14 H10 N2 O2 S |
| SMILES |
c12ccccc1C1=Nc3c(CN1S2(=O)=O)cccc3 |
| Title of publication |
7<i>H</i>-[1,2]Benzothiazolo[3,2-<i>b</i>]quinazoline 5,5-dioxide |
| Authors of publication |
Narayanan, Ponmudisettu; Karthikeyan, Subramani; Srinivasan, Panayancheri Coleppa; Sethusankar, Krishnan |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
11 |
| Pages of publication |
o3082 |
| a |
7.9389 ± 0.0002 Å |
| b |
13.146 ± 0.0004 Å |
| c |
22.7952 ± 0.0007 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2379.02 ± 0.12 Å3 |
| Cell temperature |
295 ± 2 K |
| Ambient diffraction temperature |
295 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
61 |
| Hermann-Mauguin space group symbol |
P b c a |
| Hall space group symbol |
-P 2ac 2ab |
| Residual factor for all reflections |
0.0408 |
| Residual factor for significantly intense reflections |
0.0336 |
| Weighted residual factors for significantly intense reflections |
0.1111 |
| Weighted residual factors for all reflections included in the refinement |
0.1216 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.058 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2236586.html