Information card for entry 2236595
| Chemical name |
5-Amino-3-ethoxy-1,8,8-trimethyl-2-azabicyclo[2.2.2]octa-2,5-diene-4,6-dicarbonitrile |
| Formula |
C14 H18 N4 O |
| Calculated formula |
C14 H18 N4 O |
| SMILES |
O(C1=N[C@@]2(C(=C(N)[C@]1(C(C2)(C)C)C#N)C#N)C)CC.O(C1=N[C@]2(C(=C(N)[C@@]1(C(C2)(C)C)C#N)C#N)C)CC |
| Title of publication |
5-Amino-3-ethoxy-1,8,8-trimethyl-2-azabicyclo[2.2.2]octa-2,5-diene-4,6-dicarbonitrile |
| Authors of publication |
Chantrapromma, Suchada; Suwunwong, Thitipone; Ruanwas, Pumsak; Boonnak, Nawong; Fun, Hoong-Kun |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
9 |
| Pages of publication |
o2606 - o2607 |
| a |
9.1115 ± 0.0001 Å |
| b |
12.4407 ± 0.0002 Å |
| c |
13.4945 ± 0.0002 Å |
| α |
62.945 ± 0.001° |
| β |
85.382 ± 0.001° |
| γ |
89.339 ± 0.001° |
| Cell volume |
1357.29 ± 0.04 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0627 |
| Residual factor for significantly intense reflections |
0.0474 |
| Weighted residual factors for significantly intense reflections |
0.101 |
| Weighted residual factors for all reflections included in the refinement |
0.1088 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.048 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2236595.html