Information card for entry 2236681
| Common name |
2,9-DM-1,10-phen.Hg(SCN)2 |
| Chemical name |
(2,9-Dimethyl-1,10-phenanthroline-κ^2^<i>N</i>,<i>N</i>')bis(thiocyanato- κ<i>S</i>)mercury(II) |
| Formula |
C16 H12 Hg N4 S2 |
| Calculated formula |
C16 H12 Hg N4 S2 |
| SMILES |
[Hg]1(SC#N)(SC#N)[n]2c3c4[n]1c(ccc4ccc3ccc2C)C |
| Title of publication |
(2,9-Dimethyl-1,10-phenanthroline-κ^2^<i>N</i>,<i>N</i>')bis(thiocyanato-κ<i>S</i>)mercury(II) |
| Authors of publication |
Warad, Ismail; Hadda, Taibi Ben; Hammouti, Belkheir; Haddad, Salim F. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
10 |
| Pages of publication |
m1259 |
| a |
8.1593 ± 0.0004 Å |
| b |
11.2985 ± 0.0005 Å |
| c |
18.9456 ± 0.0009 Å |
| α |
77.205 ± 0.004° |
| β |
84.015 ± 0.004° |
| γ |
89.802 ± 0.004° |
| Cell volume |
1693.55 ± 0.14 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.045 |
| Residual factor for significantly intense reflections |
0.0325 |
| Weighted residual factors for significantly intense reflections |
0.0606 |
| Weighted residual factors for all reflections included in the refinement |
0.0657 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.017 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2236681.html