Information card for entry 2236688
| Chemical name |
Bis[4-amino-3,5-bis(pyridin-2-yl)-4<i>H</i>-1,2,4-triazole- κ^2^<i>N</i>^1^,<i>N</i>^5^]diaquacobalt(II) bis(perchlorate) |
| Formula |
C24 H24 Cl2 Co N12 O10 |
| Calculated formula |
C24 H24 Cl2 Co N12 O10 |
| SMILES |
c12c3[n](nc(c4ccccn4)n3N)[Co]3([n]2cccc1)([OH2])([n]1c(c2[n]3nc(c3ccccn3)n2N)cccc1)[OH2].[O-]Cl(=O)(=O)=O.[O-]Cl(=O)(=O)=O |
| Title of publication |
Bis[4-amino-3,5-bis(pyridin-2-yl)-4<i>H</i>-1,2,4-triazole-κ^2^<i>N</i>^1^,<i>N</i>^5^]diaquacobalt(II) bis(perchlorate) |
| Authors of publication |
Feng, Mi; Ji, Yu-Fei; Liang, Sheng-Li; Liu, Zhi-Liang |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
10 |
| Pages of publication |
m1272 - m1273 |
| a |
8.5839 ± 0.0017 Å |
| b |
12.95 ± 0.003 Å |
| c |
14.975 ± 0.005 Å |
| α |
90° |
| β |
114.34 ± 0.02° |
| γ |
90° |
| Cell volume |
1516.7 ± 0.7 Å3 |
| Cell temperature |
293 K |
| Ambient diffraction temperature |
293 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0574 |
| Residual factor for significantly intense reflections |
0.0495 |
| Weighted residual factors for significantly intense reflections |
0.116 |
| Weighted residual factors for all reflections included in the refinement |
0.1213 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.069 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2236688.html