Information card for entry 2236694
| Common name |
I |
| Chemical name |
(18-Crown-6)potassium [(1,2,5,6-η)-cycloocta-1,5-diene][(1,2,3,4-η)-naphthalene]ferrate(-I) |
| Formula |
C30 H44 Fe K O6 |
| Calculated formula |
C30 H44 Fe K O6 |
| SMILES |
[Fe]123456([CH]7=[CH]1[CH]2=[CH]3c1ccccc71)[CH]1=[CH]4CC[CH]5=[CH]6CC1.[K]12345[O]6CC[O]1CC[O]2CC[O]3CC[O]4CC[O]5CC6 |
| Title of publication |
(18-Crown-6)potassium [(1,2,5,6-η)-cycloocta-1,5-diene][(1,2,3,4-η)-naphthalene]ferrate({-}I) |
| Authors of publication |
Brennessel, William W.; Ellis, John E. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
10 |
| Pages of publication |
m1230 - m1231 |
| a |
9.244 ± 0.001 Å |
| b |
10.5285 ± 0.0012 Å |
| c |
15.971 ± 0.002 Å |
| α |
76.085 ± 0.002° |
| β |
89.651 ± 0.002° |
| γ |
74.949 ± 0.002° |
| Cell volume |
1454.4 ± 0.3 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0418 |
| Residual factor for significantly intense reflections |
0.0311 |
| Weighted residual factors for significantly intense reflections |
0.069 |
| Weighted residual factors for all reflections included in the refinement |
0.0727 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.039 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2236694.html