Information card for entry 2237080
| Chemical name |
<i>catena</i>-Poly[[(4,4'-dimethyl-2,2'-bipyridine- κ^2^<i>N</i>,<i>N</i>')cadmium]-di-μ-bromido] |
| Formula |
C12 H12 Br2 Cd N2 |
| Calculated formula |
C12 H12 Br2 Cd N2 |
| SMILES |
[Cd]12([n]3ccc(C)cc3c3[n]2ccc(C)c3)[Br][Cd]2([Br]1)(Br)(Br)[n]1ccc(C)cc1c1[n]2ccc(C)c1 |
| Title of publication |
<i>catena</i>-Poly[[(4,4'-dimethyl-2,2'-bipyridine-κ^2^<i>N</i>,<i>N</i>')cadmium]-di-μ-bromido] |
| Authors of publication |
Shirvan, Sadif A.; Haydari Dezfuli, Sara; Khazali, Fereydoon; Borsalani, Ali |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
12 |
| Pages of publication |
m1493 - m1494 |
| a |
17.979 ± 0.004 Å |
| b |
10.5319 ± 0.0018 Å |
| c |
7.4496 ± 0.0016 Å |
| α |
90° |
| β |
108.403 ± 0.017° |
| γ |
90° |
| Cell volume |
1338.5 ± 0.5 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.1191 |
| Residual factor for significantly intense reflections |
0.0793 |
| Weighted residual factors for significantly intense reflections |
0.1449 |
| Weighted residual factors for all reflections included in the refinement |
0.1549 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.236 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2237080.html