Information card for entry 2237104
| Chemical name |
<i>rac</i>-Ethyl 2-hydroxy-2,7,7-trimethyl-4-(4-nitrophenyl)-5-oxo-3,4,5,6,7,8-hexahydro- 2<i>H</i>-chromene-3-carboxylate |
| Formula |
C21 H25 N O7 |
| Calculated formula |
C21 H25 N O7 |
| SMILES |
O1[C@@](O)([C@H]([C@@H](C2=C1CC(CC2=O)(C)C)c1ccc(N(=O)=O)cc1)C(=O)OCC)C.O1[C@](O)([C@@H]([C@H](C2=C1CC(CC2=O)(C)C)c1ccc(N(=O)=O)cc1)C(=O)OCC)C |
| Title of publication |
<i>rac</i>-Ethyl 2-hydroxy-2,7,7-trimethyl-4-(4-nitrophenyl)-5-oxo-3,4,5,6,7,8-hexahydro-2<i>H</i>-chromene-3-carboxylate |
| Authors of publication |
Maharramov, Abel M.; Ismiev, Arif I.; Rashidov, Bahruz A.; Askerov, Rizvan K.; Potekhin, Konstantin A. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2013 |
| Journal volume |
69 |
| Journal issue |
1 |
| Pages of publication |
o99 |
| a |
10.4163 ± 0.0008 Å |
| b |
24.2608 ± 0.0018 Å |
| c |
8.0796 ± 0.0006 Å |
| α |
90° |
| β |
96.437 ± 0.002° |
| γ |
90° |
| Cell volume |
2028.9 ± 0.3 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0576 |
| Residual factor for significantly intense reflections |
0.0441 |
| Weighted residual factors for significantly intense reflections |
0.109 |
| Weighted residual factors for all reflections included in the refinement |
0.1184 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2237104.html