Information card for entry 2237163
| Chemical name |
[2,6-Bis(5-ethoxy-1,3-oxazol-2-yl)-4-methoxyphenyl- κ^3^<i>N</i>,<i>C</i>^1^,<i>N</i>']bromidopalladium(II) |
| Formula |
C17 H17 Br N2 O5 Pd |
| Calculated formula |
C17 H17 Br N2 O5 Pd |
| SMILES |
[Pd]12([n]3c(oc(OCC)c3)c3cc(OC)cc(c4oc(OCC)c[n]14)c23)Br |
| Title of publication |
[2,6-Bis(5-ethoxy-1,3-oxazol-2-yl)-4-methoxyphenyl-κ^3^<i>N</i>,<i>C</i>^1^,<i>N</i>']bromidopalladium(II) |
| Authors of publication |
Nan, Wen-Hui; Tan, Jian-Ping; Luo, Qun-Li |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2013 |
| Journal volume |
69 |
| Journal issue |
1 |
| Pages of publication |
m31 - m32 |
| a |
9.0209 ± 0.0003 Å |
| b |
9.6544 ± 0.0003 Å |
| c |
10.92 ± 0.0003 Å |
| α |
87.093 ± 0.002° |
| β |
86.974 ± 0.001° |
| γ |
85.793 ± 0.002° |
| Cell volume |
946.1 ± 0.05 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0431 |
| Residual factor for significantly intense reflections |
0.0355 |
| Weighted residual factors for significantly intense reflections |
0.1063 |
| Weighted residual factors for all reflections included in the refinement |
0.1133 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.083 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2237163.html