Information card for entry 2237191
| Chemical name |
9-(4-Hydroxy-3-methoxyphenyl)-3,3,6,6-tetramethyl-1,2,3,4,5,6,7,8,9,10- decahydroacridine-1,8-dione |
| Formula |
C24 H29 N O4 |
| Calculated formula |
C24 H29 N O4 |
| SMILES |
Oc1ccc(C2C3=C(CC(CC3=O)(C)C)NC3=C2C(=O)CC(C3)(C)C)cc1OC |
| Title of publication |
9-(4-Hydroxy-3-methoxyphenyl)-3,3,6,6-tetramethyl-1,2,3,4,5,6,7,8,9,10-decahydroacridine-1,8-dione |
| Authors of publication |
Kant, Rajni; Gupta, Vivek K.; Kapoor, Kamini; Patil, D. R.; Patil, P. P.; Deshmukh, Madhukar B. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2013 |
| Journal volume |
69 |
| Journal issue |
1 |
| Pages of publication |
o100 |
| a |
10.4828 ± 0.0003 Å |
| b |
14.8973 ± 0.0004 Å |
| c |
14.2059 ± 0.0003 Å |
| α |
90° |
| β |
101.609 ± 0.002° |
| γ |
90° |
| Cell volume |
2173.09 ± 0.1 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0869 |
| Residual factor for significantly intense reflections |
0.0544 |
| Weighted residual factors for significantly intense reflections |
0.1028 |
| Weighted residual factors for all reflections included in the refinement |
0.1157 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.019 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2237191.html