Information card for entry 2237213
| Common name |
Narciclasine hemihydrate |
| Chemical name |
(2<i>S</i>,3<i>R</i>,4<i>S</i>,4a<i>R</i>)-2,3,4,7-Tetrahydroxy-3,4,4a,5- tetrahydro[1,3]dioxolo[4,5-<i>j</i>]phenanthridin-6(2<i>H</i>)-one hemihydrate |
| Formula |
C14 H14 N O7.5 |
| Calculated formula |
C14 H13.75 N O7.5 |
| SMILES |
O1COc2c1c(O)c1c(c2)C2=C[C@H](O)[C@@H](O)[C@@H](O)[C@@H]2NC1=O.O |
| Title of publication |
(2<i>S</i>,3<i>R</i>,4<i>S</i>,4a<i>R</i>)-2,3,4,7-Tetrahydroxy-3,4,4a,5-tetrahydro[1,3]dioxolo[4,5-<i>j</i>]phenanthridin-6(2<i>H</i>)-one hemihydrate |
| Authors of publication |
Jucov, Evgheni; Kornienko, Alexander; Masi, Marco; Evidente, Antonio; Antipin, Mikhail |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2013 |
| Journal volume |
69 |
| Journal issue |
1 |
| Pages of publication |
o9 - o10 |
| a |
10.90063 ± 0.00008 Å |
| b |
20.37357 ± 0.00017 Å |
| c |
11.88385 ± 0.00009 Å |
| α |
90° |
| β |
104.355 ± 0.0008° |
| γ |
90° |
| Cell volume |
2556.82 ± 0.04 Å3 |
| Cell temperature |
100 ± 0.1 K |
| Ambient diffraction temperature |
100 ± 0.1 K |
| Number of distinct elements |
4 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.0475 |
| Residual factor for significantly intense reflections |
0.0474 |
| Weighted residual factors for significantly intense reflections |
0.1212 |
| Weighted residual factors for all reflections included in the refinement |
0.1215 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.045 |
| Diffraction radiation wavelength |
1.5418 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2237213.html