Information card for entry 2237297
| Chemical name |
Diaqua(5-carboxybenzene-1,3-dicarboxylato-κ<i>O</i>^1^)[8-ethyl-5-oxo-2-(piperazin-4-ium-1-yl)-5,8-dihydropyrido[2,3-<i>d</i>]pyrimidine-6-carboxylato-κ^2^<i>O</i>^5^,<i>O</i>^6^]zinc monohydrate |
| Formula |
C23 H27 N5 O12 Zn |
| Calculated formula |
C23 H27 N5 O12 Zn |
| SMILES |
[Zn]1(OC(=O)c2cn(c3nc(N4CC[NH2+]CC4)ncc3c2=[O]1)CC)([OH2])([OH2])OC(=O)c1cc(cc(c1)C(=O)O)C(=O)[O-].O |
| Title of publication |
Diaqua(5-carboxybenzene-1,3-dicarboxylato-κ<i>O</i>^1^)[8-ethyl-5-oxo-2-(piperazin-4-ium-1-yl)-5,8-dihydropyrido[2,3-<i>d</i>]pyrimidine-6-carboxylato-κ^2^<i>O</i>^5^,<i>O</i>^6^]zinc monohydrate |
| Authors of publication |
Ye, Zhong-Li; Xin, Guang-Hua; Zhang, Fu-Tian; Xiao, Dong-Rong |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2013 |
| Journal volume |
69 |
| Journal issue |
2 |
| Pages of publication |
m127 |
| a |
13.5019 ± 0.0011 Å |
| b |
12.5743 ± 0.001 Å |
| c |
17.7314 ± 0.001 Å |
| α |
90° |
| β |
125.575 ± 0.004° |
| γ |
90° |
| Cell volume |
2448.5 ± 0.3 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.031 |
| Residual factor for significantly intense reflections |
0.0276 |
| Weighted residual factors for significantly intense reflections |
0.1012 |
| Weighted residual factors for all reflections included in the refinement |
0.1048 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.862 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2237297.html