Information card for entry 2237311
| Common name |
Desoxyhemigossypol 6-methyl ether |
| Chemical name |
6-Methoxy-10-methyl-7-(propan-2-yl)-2-oxatricyclo[6.3.1.0^4,12^]dodeca-1(11),4,6,8(12),9-pentaen-5-ol |
| Formula |
C16 H18 O3 |
| Calculated formula |
C16 H18 O3 |
| SMILES |
c12cc(cc3c(c(c(c(c13)CO2)O)OC)C(C)C)C |
| Title of publication |
Desoxyhemigossypol 6-methyl ether |
| Authors of publication |
Uzbekov, Vyacheslav V.; Talipov, Samat A.; Ibragimov, Bakhtiyar T.; Stipanovic, Robert D.; Liu, Jinggao |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2013 |
| Journal volume |
69 |
| Journal issue |
2 |
| Pages of publication |
o302 |
| a |
10.0275 ± 0.0005 Å |
| b |
11.1058 ± 0.0006 Å |
| c |
13.2938 ± 0.0008 Å |
| α |
107.797 ± 0.005° |
| β |
103.896 ± 0.005° |
| γ |
90.435 ± 0.004° |
| Cell volume |
1363.08 ± 0.14 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0729 |
| Residual factor for significantly intense reflections |
0.0499 |
| Weighted residual factors for significantly intense reflections |
0.143 |
| Weighted residual factors for all reflections included in the refinement |
0.1579 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.04 |
| Diffraction radiation wavelength |
1.54184 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2237311.html