Information card for entry 2237314
| Common name |
5-amino-3-picolinamido-1H-1,2,4-triazole |
| Chemical name |
<i>N</i>-(5-Amino-1<i>H</i>-1,2,4-triazol-3-yl)pyridine-2-carboxamide |
| Formula |
C8 H8 N6 O |
| Calculated formula |
C8 H8 N6 O |
| SMILES |
O=C(Nc1n[nH]c(N)n1)c1ncccc1 |
| Title of publication |
<i>N</i>-(5-Amino-1<i>H</i>-1,2,4-triazol-3-yl)pyridine-2-carboxamide |
| Authors of publication |
Hernández-Gil, Javier; Ferrer, Sacramento; Ballesteros, Rafael; Castiñeiras, Alfonso |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2013 |
| Journal volume |
69 |
| Journal issue |
2 |
| Pages of publication |
o227 - o228 |
| a |
9.548 ± 0.0005 Å |
| b |
9.548 ± 0.0005 Å |
| c |
21.957 ± 0.0009 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2001.69 ± 0.17 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
92 |
| Hermann-Mauguin space group symbol |
P 41 21 2 |
| Hall space group symbol |
P 4abw 2nw |
| Residual factor for all reflections |
0.0715 |
| Residual factor for significantly intense reflections |
0.0384 |
| Weighted residual factors for significantly intense reflections |
0.0896 |
| Weighted residual factors for all reflections included in the refinement |
0.1068 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.067 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2237314.html