Information card for entry 2237320
| Chemical name |
<i>endo</i>,<i>endo</i>-Tetracyclo[6.2.1.1^3,6^.0^2,7^]dodeca- 9-en-<i>anti</i>-11-yl 4-bromobenzoate |
| Formula |
C19 H19 Br O2 |
| Calculated formula |
C19 H19 Br O2 |
| SMILES |
Brc1ccc(C(=O)OC2[C@H]3[C@@H]4[C@@H]5CC[C@H]([C@@H]4[C@@H]2C=C3)C5)cc1 |
| Title of publication |
<i>endo</i>,<i>endo</i>-Tetracyclo[6.2.1.1^3,6^.0^2,7^]dodeca-9-en-<i>anti</i>-11-yl 4-bromobenzoate |
| Authors of publication |
Lloyd, Barry A.; Arif, Atta M.; Coots, Robert J. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2013 |
| Journal volume |
69 |
| Journal issue |
2 |
| Pages of publication |
o202 - o203 |
| a |
13.2569 ± 0.0002 Å |
| b |
10.5045 ± 0.0002 Å |
| c |
12.2039 ± 0.0002 Å |
| α |
90° |
| β |
116.012 ± 0.0009° |
| γ |
90° |
| Cell volume |
1527.32 ± 0.05 Å3 |
| Cell temperature |
150 ± 1 K |
| Ambient diffraction temperature |
150 ± 1 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0452 |
| Residual factor for significantly intense reflections |
0.0276 |
| Weighted residual factors for significantly intense reflections |
0.0577 |
| Weighted residual factors for all reflections included in the refinement |
0.0632 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.029 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2237320.html