Information card for entry 2237339
| Chemical name |
(2-Amino-7-methyl-4-oxidopteridine-6-carboxylato- κ^3^<i>O</i>^4^,<i>N</i>^5^,<i>O</i>^6^)aqua(ethane-1,2-diamine- κ^2^<i>N</i>,<i>N</i>')nickel(II) dihydrate |
| Formula |
C10 H19 N7 Ni O6 |
| Calculated formula |
C10 H19 N7 Ni O6 |
| SMILES |
[Ni]123(OC(=O)c4[n]1c1c(nc4C)nc(nc1O2)N)([OH2])[NH2]CC[NH2]3.O.O |
| Title of publication |
(2-Amino-7-methyl-4-oxidopteridine-6-carboxylato-κ^3^<i>O</i>^4^,<i>N</i>^5^,<i>O</i>^6^)aqua(ethane-1,2-diamine-κ^2^<i>N</i>,<i>N</i>')nickel(II) dihydrate |
| Authors of publication |
Baisya, Siddhartha S.; Roy, Parag S. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2013 |
| Journal volume |
69 |
| Journal issue |
2 |
| Pages of publication |
m99 - m100 |
| a |
10.406 ± 0.004 Å |
| b |
14.323 ± 0.005 Å |
| c |
10.45 ± 0.004 Å |
| α |
90° |
| β |
93.294 ± 0.006° |
| γ |
90° |
| Cell volume |
1554.9 ± 1 Å3 |
| Cell temperature |
293 K |
| Ambient diffraction temperature |
293 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0641 |
| Residual factor for significantly intense reflections |
0.0501 |
| Weighted residual factors for all reflections |
0.1348 |
| Weighted residual factors for significantly intense reflections |
0.1258 |
| Weighted residual factors for all reflections included in the refinement |
0.1348 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.9145 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2237339.html