Information card for entry 2237351
| Chemical name |
<i>rac</i>-1-[6-Hydroxy-4-(4-methoxyphenyl)-3,6-dimethyl-4,5,6,7- tetrahydro-2<i>H</i>-indazol-5-yl]ethanone |
| Formula |
C18 H22 N2 O3 |
| Calculated formula |
C18 H22 N2 O3 |
| SMILES |
O[C@]1(Cc2n[nH]c(c2[C@@H]([C@H]1C(=O)C)c1ccc(OC)cc1)C)C.O[C@@]1(Cc2n[nH]c(c2[C@H]([C@@H]1C(=O)C)c1ccc(OC)cc1)C)C |
| Title of publication |
<i>rac</i>-1-[6-Hydroxy-4-(4-methoxyphenyl)-3,6-dimethyl-4,5,6,7-tetrahydro-2<i>H</i>-indazol-5-yl]ethanone |
| Authors of publication |
Potekhin, Konstantin A.; Askerov, Rizvan K.; Hajiyeva, Kushvar E.; Gadirova, Narmina A.; Nazarov, Shahkaram I. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2013 |
| Journal volume |
69 |
| Journal issue |
2 |
| Pages of publication |
o243 |
| a |
18.3693 ± 0.0014 Å |
| b |
5.6971 ± 0.0004 Å |
| c |
16.3049 ± 0.0012 Å |
| α |
90° |
| β |
109.526 ± 0.001° |
| γ |
90° |
| Cell volume |
1608.2 ± 0.2 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.091 |
| Residual factor for significantly intense reflections |
0.0574 |
| Weighted residual factors for significantly intense reflections |
0.136 |
| Weighted residual factors for all reflections included in the refinement |
0.1513 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.002 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2237351.html