Information card for entry 2237362
| Common name |
1,2-Ethanediylbis(2-hydroxybenzamide) |
| Chemical name |
2,2'-Dihydroxy-<i>N</i>,<i>N</i>'-(ethane-1,2-diyl)dibenzamide |
| Formula |
C16 H16 N2 O4 |
| Calculated formula |
C16 H16 N2 O4 |
| SMILES |
O=C(c1ccccc1O)NCCNC(=O)c1ccccc1O |
| Title of publication |
2,2'-Dihydroxy-<i>N</i>,<i>N</i>'-(ethane-1,2-diyl)dibenzamide |
| Authors of publication |
da Costa, Daniel Pereira; Nobre, Sabrina Madruga; Lisboa, Bruna Gonçalves; de Vicenti, Juliano Rosa; Back, Davi Fernando |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2013 |
| Journal volume |
69 |
| Journal issue |
2 |
| Pages of publication |
o201 |
| a |
4.6311 ± 0.0003 Å |
| b |
5.0435 ± 0.0003 Å |
| c |
15.2957 ± 0.0009 Å |
| α |
89.091 ± 0.004° |
| β |
83.315 ± 0.004° |
| γ |
85.956 ± 0.004° |
| Cell volume |
353.94 ± 0.04 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0882 |
| Residual factor for significantly intense reflections |
0.0486 |
| Weighted residual factors for significantly intense reflections |
0.122 |
| Weighted residual factors for all reflections included in the refinement |
0.1427 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.012 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2237362.html