| Chemical name |
<i>anti</i>-2,2,3,3,6,6,7,7,10,10,11,11,14,14,15,15-Hexadecamethyl-2,3,6,7,10,11,14,15-octasilapentacyclo[10.4.2.2^4,9^.0^5,8^.0^13,16^]icosa-1(17),4,8,12(18),13(16),19-hexaene |
| Formula |
C28 H52 Si8 |
| Calculated formula |
C28 H52 Si8 |
| SMILES |
c12c3[Si](C)(C)[Si](c3c(cc2)[Si](C)(C)[Si](c2c3c(c(cc2)[Si](C)(C)[Si]1(C)C)[Si](C)(C)[Si]3(C)C)(C)C)(C)C |
| Title of publication |
<i>anti</i>-2,2,3,3,6,6,7,7,10,10,11,11,14,14,15,15-Hexadecamethyl-2,3,6,7,10,11,14,15-octasilapentacyclo[10.4.2.2^4,9^.0^5,8^.0^13,16^]icosa-1(17),4,8,12(18),13(16),19-hexaene |
| Authors of publication |
Toma, Yuki; Otsuka, Kyohei; Kyushin, Soichiro |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2013 |
| Journal volume |
69 |
| Journal issue |
3 |
| Pages of publication |
o341 |
| a |
7.9801 ± 0.0008 Å |
| b |
18.9087 ± 0.0014 Å |
| c |
12.6222 ± 0.001 Å |
| α |
90° |
| β |
104.279 ± 0.0009° |
| γ |
90° |
| Cell volume |
1845.8 ± 0.3 Å3 |
| Cell temperature |
203 ± 2 K |
| Ambient diffraction temperature |
203 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0293 |
| Residual factor for significantly intense reflections |
0.0291 |
| Weighted residual factors for significantly intense reflections |
0.0754 |
| Weighted residual factors for all reflections included in the refinement |
0.0756 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.109 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
