Information card for entry 2237487
| Chemical name |
4-Dimethylamino-1-(4-methoxyphenyl)-2,5-dioxo-2,5-dihydro-1<i>H</i>-pyrrole-3-carbonitrile |
| Formula |
C14 H13 N3 O3 |
| Calculated formula |
C14 H13 N3 O3 |
| SMILES |
O=C1N(C(=O)C(=C1N(C)C)C#N)c1ccc(OC)cc1 |
| Title of publication |
4-Dimethylamino-1-(4-methoxyphenyl)-2,5-dioxo-2,5-dihydro-1<i>H</i>-pyrrole-3-carbonitrile |
| Authors of publication |
Abdel-Wahab, Bakr F.; Mohamed, Hanan A.; Farahat, Abdelbasset A.; Ng, Seik Weng; Tiekink, Edward R. T. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2013 |
| Journal volume |
69 |
| Journal issue |
3 |
| Pages of publication |
o437 |
| a |
12.7408 ± 0.0014 Å |
| b |
7.852 ± 0.0009 Å |
| c |
14.4194 ± 0.0018 Å |
| α |
90° |
| β |
115.163 ± 0.014° |
| γ |
90° |
| Cell volume |
1305.6 ± 0.3 Å3 |
| Cell temperature |
295 ± 2 K |
| Ambient diffraction temperature |
295 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0996 |
| Residual factor for significantly intense reflections |
0.0535 |
| Weighted residual factors for significantly intense reflections |
0.1285 |
| Weighted residual factors for all reflections included in the refinement |
0.1525 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.037 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2237487.html