Information card for entry 2237549
| Chemical name |
bis(3,5-diamino-4<i>H</i>-1,2,4-triazol-1-ium) 3,4-dioxocyclobutane-1,2-diolate |
| Formula |
C8 H12 N10 O4 |
| Calculated formula |
C8 H12 N10 O4 |
| SMILES |
O=C1C([O-])=C([O-])C1=O.[nH]1c(n[nH+]c1N)N.[nH]1c(n[nH+]c1N)N |
| Title of publication |
Bis(3,5-diamino-4<i>H</i>-1,2,4-triazol-1-ium) 3,4-dioxocyclobutane-1,2-diolate |
| Authors of publication |
Fun, Hoong-Kun; Loh, Wan-Sin; Johnson, Atim; Yousuf, Sammer; Eno, Ededet |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2013 |
| Journal volume |
69 |
| Journal issue |
3 |
| Pages of publication |
o353 - o354 |
| a |
15.7186 ± 0.0002 Å |
| b |
11.6533 ± 0.0002 Å |
| c |
6.8618 ± 0.0001 Å |
| α |
90° |
| β |
91.734 ± 0.001° |
| γ |
90° |
| Cell volume |
1256.32 ± 0.03 Å3 |
| Cell temperature |
100 ± 1 K |
| Ambient diffraction temperature |
100 ± 0.1 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0548 |
| Residual factor for significantly intense reflections |
0.0396 |
| Weighted residual factors for significantly intense reflections |
0.0985 |
| Weighted residual factors for all reflections included in the refinement |
0.1081 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.033 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2237549.html