Information card for entry 2237645
| Common name |
Diels-Alder Adduct |
| Chemical name |
Diethyl 1,8-bis(4-methylphenyl)-11-oxatricyclo[6.2.1.0^2,7^]undeca-2,4,6-triene-9,10-dicarboxylate |
| Formula |
C30 H30 O5 |
| Calculated formula |
C30 H30 O5 |
| SMILES |
CCOC(=O)[C@@H]1[C@H](C(=O)OCC)[C@]2(O[C@]1(c1ccc(cc1)C)c1c2cccc1)c1ccc(cc1)C |
| Title of publication |
Diethyl 1,8-bis(4-methylphenyl)-11-oxatricyclo[6.2.1.0^2,7^]undeca-2,4,6-triene-9,10-dicarboxylate |
| Authors of publication |
Balakrishnan, B.; Nandakumar, Meganathan; Seshadri, Pandamangalam R.; Mohanakrishnan, Arasambattu K. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2013 |
| Journal volume |
69 |
| Journal issue |
4 |
| Pages of publication |
o500 |
| a |
9.8722 ± 0.0003 Å |
| b |
10.7413 ± 0.0003 Å |
| c |
13.3081 ± 0.0003 Å |
| α |
109.319 ± 0.001° |
| β |
105.045 ± 0.001° |
| γ |
90.374 ± 0.001° |
| Cell volume |
1279.46 ± 0.06 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0472 |
| Residual factor for significantly intense reflections |
0.0383 |
| Weighted residual factors for significantly intense reflections |
0.1021 |
| Weighted residual factors for all reflections included in the refinement |
0.1119 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.031 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2237645.html