Information card for entry 2237729
| Chemical name |
Poly[[(μ~4~-1,3,5-triamino-1,3,5-trideoxy-<i>cis</i>-inositol)sodium] bromide] |
| Formula |
C6 H15 Br N3 Na O3 |
| Calculated formula |
C6 H15 Br N3 Na O3 |
| SMILES |
[Br-].[C@@H]1([C@@H](O)[C@H]([C@H]([C@H]([C@H]1O)N)O)N)N.[Na+] |
| Title of publication |
Poly[[(μ~4~-1,3,5-triamino-1,3,5-trideoxy-<i>cis</i>-inositol)sodium] bromide] |
| Authors of publication |
Reiss, Guido J.; Hegetschweiler, Kaspar |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2013 |
| Journal volume |
69 |
| Journal issue |
4 |
| Pages of publication |
m185 - m186 |
| a |
8.0491 ± 0.001 Å |
| b |
8.0491 ± 0.001 Å |
| c |
8.8953 ± 0.0018 Å |
| α |
90° |
| β |
90° |
| γ |
120° |
| Cell volume |
499.1 ± 0.13 Å3 |
| Cell temperature |
153 ± 2 K |
| Ambient diffraction temperature |
153 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
159 |
| Hermann-Mauguin space group symbol |
P 3 1 c |
| Hall space group symbol |
P 3 -2c |
| Residual factor for all reflections |
0.0361 |
| Residual factor for significantly intense reflections |
0.0357 |
| Weighted residual factors for significantly intense reflections |
0.0778 |
| Weighted residual factors for all reflections included in the refinement |
0.0779 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.051 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2237729.html