Information card for entry 2237789
| Chemical name |
(<i>E</i>)-6-(4-Chlorophenyl)-4-[(2-cyano-3-phenylallyl)sulfanyl]-2,2-difluoro-3-phenyl-1,3,2-oxazaborinin-3-ium-2-uide |
| Formula |
C25 H18 B Cl F2 N2 O S |
| Calculated formula |
C25 H18 B Cl F2 N2 O S |
| SMILES |
Clc1ccc(cc1)C1=CC(SCC(=C\c2ccccc2)\C#N)=[N](c2ccccc2)[B](F)(F)O1 |
| Title of publication |
(<i>E</i>)-6-(4-Chlorophenyl)-4-[(2-cyano-3-phenylallyl)sulfanyl]-2,2-difluoro-3-phenyl-1,3,2-oxazaborinin-3-ium-2-uide |
| Authors of publication |
Li, Ming; Wang, Shu-Wen; Wen, Li-Rong |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2013 |
| Journal volume |
69 |
| Journal issue |
5 |
| Pages of publication |
o648 |
| a |
9.6996 ± 0.0019 Å |
| b |
16.29 ± 0.003 Å |
| c |
14.168 ± 0.003 Å |
| α |
90° |
| β |
98.71 ± 0.03° |
| γ |
90° |
| Cell volume |
2212.8 ± 0.8 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173 ± 2 K |
| Number of distinct elements |
8 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0687 |
| Residual factor for significantly intense reflections |
0.0582 |
| Weighted residual factors for significantly intense reflections |
0.1148 |
| Weighted residual factors for all reflections included in the refinement |
0.1202 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.18 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2237789.html