Information card for entry 2237803
| Chemical name |
2-(4-Methylpyridin-2-yl)-4',4',6',6'-tetrakis(pyrrolidin-1-yl)-1<i>H</i>,2<i>H</i>-spiro[naphtho[1,2-<i>e</i>][1,3,2]oxazaphosphinine-3,2'-[1,3,5,2,4,6]triazatriphosphinine] |
| Formula |
C33 H46 N9 O P3 |
| Calculated formula |
C33 H46 N9 O P3 |
| SMILES |
P12(Oc3ccc4c(cccc4)c3CN2c2nccc(c2)C)=NP(=NP(=N1)(N1CCCC1)N1CCCC1)(N1CCCC1)N1CCCC1 |
| Title of publication |
2-(4-Methylpyridin-2-yl)-4',4',6',6'-tetrakis(pyrrolidin-1-yl)-1<i>H</i>,2<i>H</i>-spiro[naphtho[1,2-<i>e</i>][1,3,2]oxazaphosphinine-3,2'-[1,3,5,2,4,6]triazatriphosphinine] |
| Authors of publication |
Işıklan, Muhammet; Sonkaya, Ömer; Hökelek, Tuncer |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2013 |
| Journal volume |
69 |
| Journal issue |
6 |
| Pages of publication |
o994 - o995 |
| a |
9.583 ± 0.0002 Å |
| b |
10.9142 ± 0.0002 Å |
| c |
16.8172 ± 0.0003 Å |
| α |
79.21 ± 0.002° |
| β |
84.542 ± 0.003° |
| γ |
74.193 ± 0.002° |
| Cell volume |
1660.68 ± 0.06 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0505 |
| Residual factor for significantly intense reflections |
0.0395 |
| Weighted residual factors for significantly intense reflections |
0.102 |
| Weighted residual factors for all reflections included in the refinement |
0.1088 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.035 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2237803.html