Information card for entry 2237842
| Common name |
(<i>E</i>,<i>E</i>,<i>E</i>)-1,6-Bis(4-chlorophenyl)hexa-1,3,5-triene |
| Chemical name |
<i>trans</i>,<i>trans</i>,<i>trans</i>-1,6-Bis(4-chlorophenyl)hexa-1,3,5-triene |
| Formula |
C18 H14 Cl2 |
| Calculated formula |
C18 H14 Cl2 |
| SMILES |
Clc1ccc(cc1)/C=C/C=C/C=C/c1ccc(cc1)Cl |
| Title of publication |
(<i>E</i>,<i>E</i>,<i>E</i>)-1,6-Bis(4-chlorophenyl)hexa-1,3,5-triene |
| Authors of publication |
Li, Zhiying |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2013 |
| Journal volume |
69 |
| Journal issue |
5 |
| Pages of publication |
o699 |
| a |
15.6277 ± 0.0007 Å |
| b |
4.0784 ± 0.0002 Å |
| c |
12.1026 ± 0.0005 Å |
| α |
90° |
| β |
105.81 ± 0.004° |
| γ |
90° |
| Cell volume |
742.19 ± 0.06 Å3 |
| Cell temperature |
290.51 ± 0.1 K |
| Ambient diffraction temperature |
290.51 ± 0.1 K |
| Number of distinct elements |
3 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0533 |
| Residual factor for significantly intense reflections |
0.0394 |
| Weighted residual factors for significantly intense reflections |
0.0905 |
| Weighted residual factors for all reflections included in the refinement |
0.1046 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.059 |
| Diffraction radiation wavelength |
0.7107 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2237842.html