Information card for entry 2237861
| Chemical name |
5-(Adamantan-1-yl)-3-[(4-fluoroanilino)methyl]-2,3-dihydro-1,3,4-oxadiazole-2-thione |
| Formula |
C19 H22 F N3 O S |
| Calculated formula |
C19 H22 F N3 O S |
| SMILES |
S=C1OC(=NN1CNc1ccc(F)cc1)C12CC3CC(C1)CC(C2)C3 |
| Title of publication |
5-(Adamantan-1-yl)-3-[(4-fluoroanilino)methyl]-2,3-dihydro-1,3,4-oxadiazole-2-thione |
| Authors of publication |
Al-Tamimi, Abdul-Malek S.; Alafeefy, Ahmed M.; El-Emam, Ali A.; Ng, Seik Weng; Tiekink, Edward R. T. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2013 |
| Journal volume |
69 |
| Journal issue |
5 |
| Pages of publication |
o730 |
| a |
7.1683 ± 0.0008 Å |
| b |
10.6621 ± 0.0011 Å |
| c |
23.592 ± 0.003 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1803.1 ± 0.4 Å3 |
| Cell temperature |
295 ± 2 K |
| Ambient diffraction temperature |
295 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.1182 |
| Residual factor for significantly intense reflections |
0.0625 |
| Weighted residual factors for significantly intense reflections |
0.1283 |
| Weighted residual factors for all reflections included in the refinement |
0.1583 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.983 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2237861.html