Information card for entry 2237887
| Chemical name |
1,1'-(Ethane-1,2-diyl)dipyridinium bis(1,2-dicyanoethene-1,2-dithiolato-κ^2^<i>S</i>,<i>S</i>')cuprate(II) |
| Formula |
C20 H14 Cu N6 S4 |
| Calculated formula |
C20 H14 Cu N6 S4 |
| SMILES |
C1(S[Cu]2(SC=1C#N)SC(C#N)=C(S2)C#N)C#N.c1cccc[n+]1CC[n+]1ccccc1 |
| Title of publication |
1,1'-(Ethane-1,2-diyl)dipyridinium bis(1,2-dicyanoethene-1,2-dithiolato-κ^2^<i>S</i>,<i>S</i>')cuprate(II) |
| Authors of publication |
Hu, Bing-Xiang; Zhou, Chang-Xiao; Liu, Yang-Mei; Chen, Li-Zhuang; Wang, Fang-Ming |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2013 |
| Journal volume |
69 |
| Journal issue |
6 |
| Pages of publication |
m312 |
| a |
7.7598 ± 0.001 Å |
| b |
12.3811 ± 0.0015 Å |
| c |
12.6572 ± 0.0016 Å |
| α |
77.676 ± 0.002° |
| β |
72.791 ± 0.002° |
| γ |
84.122 ± 0.002° |
| Cell volume |
1133.8 ± 0.2 Å3 |
| Cell temperature |
291 ± 2 K |
| Ambient diffraction temperature |
291 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0434 |
| Residual factor for significantly intense reflections |
0.0358 |
| Weighted residual factors for significantly intense reflections |
0.0808 |
| Weighted residual factors for all reflections included in the refinement |
0.0832 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.001 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2237887.html