Information card for entry 2238018
| Chemical name |
Ethyl 2-oxo-3-(3-phthalimidopropyl)-2,3-dihydro-1<i>H</i>-1,3-benzimidazole-1-carboxylate |
| Formula |
C21 H19 N3 O5 |
| Calculated formula |
C21 H19 N3 O5 |
| SMILES |
CCOC(=O)N1C(=O)N(c2c1cccc2)CCCN1C(=O)c2c(C1=O)cccc2 |
| Title of publication |
Ethyl 2-oxo-3-(3-phthalimidopropyl)-2,3-dihydro-1<i>H</i>-1,3-benzimidazole-1-carboxylate |
| Authors of publication |
Belaziz, Dounia; Kandri Rodi, Youssef; Kandri Rodi, Adiba; Essassi, El Mokhtar; Saadi, Mohamed; El Ammari, Lahcen |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2013 |
| Journal volume |
69 |
| Journal issue |
5 |
| Pages of publication |
o641 - o642 |
| a |
5.285 ± 0.0007 Å |
| b |
10.6663 ± 0.0012 Å |
| c |
16.505 ± 0.002 Å |
| α |
86.454 ± 0.007° |
| β |
83.424 ± 0.008° |
| γ |
89.376 ± 0.007° |
| Cell volume |
922.5 ± 0.2 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0759 |
| Residual factor for significantly intense reflections |
0.0509 |
| Weighted residual factors for significantly intense reflections |
0.1282 |
| Weighted residual factors for all reflections included in the refinement |
0.145 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.043 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2238018.html