Information card for entry 2238060
| Chemical name |
4-Hydroxy-1,2,6-trimethylpyridinium bromide monohydrate |
| Formula |
C8 H14 Br N O2 |
| Calculated formula |
C8 H14 Br N O2 |
| SMILES |
[Br-].Oc1cc([n+](c(c1)C)C)C.O |
| Title of publication |
4-Hydroxy-1,2,6-trimethylpyridinium bromide monohydrate |
| Authors of publication |
Seethalakshmi, T.; Manivannan, S.; Dhanuskodi, S.; Lynch, Daniel E.; Thamotharan, S. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2013 |
| Journal volume |
69 |
| Journal issue |
6 |
| Pages of publication |
o941 - o942 |
| a |
8.4796 ± 0.0004 Å |
| b |
8.5874 ± 0.0006 Å |
| c |
13.8479 ± 0.0009 Å |
| α |
90° |
| β |
99.504 ± 0.004° |
| γ |
90° |
| Cell volume |
994.53 ± 0.11 Å3 |
| Cell temperature |
120 ± 2 K |
| Ambient diffraction temperature |
120 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0388 |
| Residual factor for significantly intense reflections |
0.0261 |
| Weighted residual factors for significantly intense reflections |
0.0525 |
| Weighted residual factors for all reflections included in the refinement |
0.0561 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.055 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2238060.html