Information card for entry 2238081
| Chemical name |
(Butane-1,2,3,4-tetraol- κ^3^<i>O</i>^1^,<i>O</i>^2^,<i>O</i>^3^)(ethanol-κ<i>O</i>)tris(nitrato-κ^2^<i>O</i>,<i>O</i>')erbium(III) |
| Formula |
C6 H16 Er N3 O14 |
| Calculated formula |
C6 H16 Er N3 O14 |
| SMILES |
[Er]12345([O]=N(=O)O1)([O]=N(=O)O3)([O]=N(=O)O2)([OH]CC)[OH][C@H]([C@H]([OH]5)CO)C[OH]4.[Er]12345([O]=N(=O)O1)([O]=N(=O)O3)([O]=N(=O)O2)([OH]CC)[OH][C@@H]([C@@H]([OH]5)CO)C[OH]4 |
| Title of publication |
(Butane-1,2,3,4-tetraol-κ^3^<i>O</i>^1^,<i>O</i>^2^,<i>O</i>^3^)(ethanol-κ<i>O</i>)tris(nitrato-κ^2^<i>O</i>,<i>O</i>')erbium(III) |
| Authors of publication |
Hua, Xiao-Hui; Xue, Jun-Hui; Yang, Li-Min; Xu, Yi-Zhuang; Wu, Jin-Guang |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2013 |
| Journal volume |
69 |
| Journal issue |
5 |
| Pages of publication |
m257 - m258 |
| a |
7.7521 ± 0.0016 Å |
| b |
12.772 ± 0.003 Å |
| c |
15.121 ± 0.003 Å |
| α |
90° |
| β |
100.26 ± 0.03° |
| γ |
90° |
| Cell volume |
1473.2 ± 0.6 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0337 |
| Residual factor for significantly intense reflections |
0.0305 |
| Weighted residual factors for significantly intense reflections |
0.0613 |
| Weighted residual factors for all reflections included in the refinement |
0.0625 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.2 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2238081.html