Information card for entry 2238158
| Chemical name |
Ethyl 4-(4-chlorophenyl)-2-methyl-5-oxo-5,6,7,8-tetrahydroquinoline-3-carboxylate |
| Formula |
C19 H18 Cl N O3 |
| Calculated formula |
C19 H18 Cl N O3 |
| SMILES |
CCOC(=O)c1c(C)nc2c(c1c1ccc(cc1)Cl)C(=O)CCC2 |
| Title of publication |
Ethyl 4-(4-chlorophenyl)-2-methyl-5-oxo-5,6,7,8-tetrahydroquinoline-3-carboxylate |
| Authors of publication |
Wang, Ke; Wang, Weike; Wang, Yifeng; Xu, Danqian |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2013 |
| Journal volume |
69 |
| Journal issue |
7 |
| Pages of publication |
o1127 |
| a |
12.5736 ± 0.0007 Å |
| b |
8.3815 ± 0.0004 Å |
| c |
17.4945 ± 0.0008 Å |
| α |
90° |
| β |
112.151 ± 0.002° |
| γ |
90° |
| Cell volume |
1707.59 ± 0.15 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0726 |
| Residual factor for significantly intense reflections |
0.0498 |
| Weighted residual factors for significantly intense reflections |
0.1109 |
| Weighted residual factors for all reflections included in the refinement |
0.1275 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2238158.html