Information card for entry 2238228
| Chemical name |
8-[(3-Phenyl-1,2,4-oxadiazol-5-yl)methoxy]quinoline monohydrate |
| Formula |
C18 H15 N3 O3 |
| Calculated formula |
C18 H15 N3 O3 |
| SMILES |
c1ccc(cc1)c1noc(n1)COc1cccc2c1nccc2.O |
| Title of publication |
8-[(3-Phenyl-1,2,4-oxadiazol-5-yl)methoxy]quinoline monohydrate |
| Authors of publication |
Bai, Shu-Yuan; Shen, Hong; Han, Xin-Yi; Lv, Ling-Jie; Wang, Hai-Bo |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2013 |
| Journal volume |
69 |
| Journal issue |
7 |
| Pages of publication |
o1034 |
| a |
7.043 ± 0.0014 Å |
| b |
7.58 ± 0.0015 Å |
| c |
29.114 ± 0.006 Å |
| α |
90° |
| β |
95.33 ± 0.03° |
| γ |
90° |
| Cell volume |
1547.6 ± 0.5 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.1069 |
| Residual factor for significantly intense reflections |
0.0521 |
| Weighted residual factors for significantly intense reflections |
0.1219 |
| Weighted residual factors for all reflections included in the refinement |
0.1438 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.954 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2238228.html