Information card for entry 2238269
| Chemical name |
(3<i>E</i>,5<i>E</i>)-1-Allyl-3,5-bis(4-methoxybenzylidene)piperidin-4-one |
| Formula |
C24 H25 N O3 |
| Calculated formula |
C24 H25 N O3 |
| SMILES |
COc1ccc(cc1)/C=C1\CN(CC=C)C/C(=C\c2ccc(cc2)OC)C1=O |
| Title of publication |
(3<i>E</i>,5<i>E</i>)-1-Allyl-3,5-bis(4-methoxybenzylidene)piperidin-4-one |
| Authors of publication |
Almansour, Abdulrahman I.; Kumar, Raju Suresh; Arumugam, Natarajan; Vishnupriya, R.; Suresh, J. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2013 |
| Journal volume |
69 |
| Journal issue |
7 |
| Pages of publication |
o1071 |
| a |
19.2409 ± 0.0015 Å |
| b |
6.8457 ± 0.0006 Å |
| c |
15.6393 ± 0.0013 Å |
| α |
90° |
| β |
98.255 ± 0.002° |
| γ |
90° |
| Cell volume |
2038.6 ± 0.3 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0869 |
| Residual factor for significantly intense reflections |
0.0496 |
| Weighted residual factors for significantly intense reflections |
0.1415 |
| Weighted residual factors for all reflections included in the refinement |
0.1691 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.027 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2238269.html