Information card for entry 2238303
| Chemical name |
<i>rac</i>-(<i>E</i>,<i>E</i>)-<i>N</i>,<i>N</i>'-Bis(2-chlorobenzylidene)cyclohexane-1,2-diamine |
| Formula |
C20 H20 Cl2 N2 |
| Calculated formula |
C20 H20 Cl2 N2 |
| SMILES |
Clc1c(/C=N/[C@H]2[C@H](/N=C/c3c(Cl)cccc3)CCCC2)cccc1.Clc1c(/C=N/[C@@H]2[C@@H](/N=C/c3c(Cl)cccc3)CCCC2)cccc1 |
| Title of publication |
<i>rac</i>-(<i>E</i>,<i>E</i>)-<i>N</i>,<i>N</i>'-Bis(2-chlorobenzylidene)cyclohexane-1,2-diamine |
| Authors of publication |
Warad, Ismail; Al-Noaimi, Mousa; Haddad, Salim F.; Al-Demeri, Yasmin; Hammouti, Belkheir |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2013 |
| Journal volume |
69 |
| Journal issue |
7 |
| Pages of publication |
o1075 |
| a |
5.9029 ± 0.0005 Å |
| b |
19.5613 ± 0.0013 Å |
| c |
16.1662 ± 0.0011 Å |
| α |
90° |
| β |
93.493 ± 0.007° |
| γ |
90° |
| Cell volume |
1863.2 ± 0.2 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0735 |
| Residual factor for significantly intense reflections |
0.0458 |
| Weighted residual factors for significantly intense reflections |
0.0921 |
| Weighted residual factors for all reflections included in the refinement |
0.1055 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.024 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2238303.html