Information card for entry 2238370
| Chemical name |
Bis(1-ethyl-4,4'-bipyridin-1-ium) bis(1,2-dicyanoethene-1,2-dithiolato-κ^2^<i>S</i>,<i>S</i>')nickelate(II) |
| Formula |
C32 H26 N8 Ni S4 |
| Calculated formula |
C32 H26 N8 Ni S4 |
| SMILES |
[Ni]12(SC(=C(S2)C#N)C#N)SC(=C(S1)C#N)C#N.c1cc(cc[n+]1CC)c1ccncc1.c1cc(cc[n+]1CC)c1ccncc1 |
| Title of publication |
Bis(1-ethyl-4,4'-bipyridin-1-ium) bis(1,2-dicyanoethene-1,2-dithiolato-κ^2^<i>S</i>,<i>S</i>')nickelate(II) |
| Authors of publication |
Chen, Yao; Ning, Wei-hua; Liu, Jian-Lan |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2013 |
| Journal volume |
69 |
| Journal issue |
8 |
| Pages of publication |
m428 |
| a |
7.4505 ± 0.0013 Å |
| b |
12.793 ± 0.002 Å |
| c |
17.745 ± 0.003 Å |
| α |
78.664 ± 0.002° |
| β |
86.558 ± 0.002° |
| γ |
80.344 ± 0.002° |
| Cell volume |
1634.2 ± 0.5 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.1348 |
| Residual factor for significantly intense reflections |
0.051 |
| Weighted residual factors for significantly intense reflections |
0.0968 |
| Weighted residual factors for all reflections included in the refinement |
0.1279 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.965 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2238370.html