Information card for entry 2238481
| Chemical name |
2-Isopropyl-2-(6-methoxy-1,3-benzothiazol-2-yl)-5,5-dimethyl-1,3-thiazolidin-4-one |
| Formula |
C16 H20 N2 O2 S2 |
| Calculated formula |
C16 H20 N2 O2 S2 |
| SMILES |
COc1ccc2c(c1)sc(n2)C1(NC(=O)C(S1)(C)C)C(C)C |
| Title of publication |
2-Isopropyl-2-(6-methoxy-1,3-benzothiazol-2-yl)-5,5-dimethyl-1,3-thiazolidin-4-one |
| Authors of publication |
Würfel, Hendryk; Görls, Helmar; Weiss, Dieter; Beckert, Rainer |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2013 |
| Journal volume |
69 |
| Journal issue |
9 |
| Pages of publication |
o1391 |
| a |
11.3755 ± 0.0003 Å |
| b |
11.9028 ± 0.0003 Å |
| c |
12.5261 ± 0.0003 Å |
| α |
86.122 ± 0.001° |
| β |
85.949 ± 0.001° |
| γ |
89.206 ± 0.001° |
| Cell volume |
1687.86 ± 0.07 Å3 |
| Cell temperature |
133 ± 2 K |
| Ambient diffraction temperature |
133 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0457 |
| Residual factor for significantly intense reflections |
0.0392 |
| Weighted residual factors for significantly intense reflections |
0.0828 |
| Weighted residual factors for all reflections included in the refinement |
0.0878 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.077 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2238481.html