Information card for entry 2238484
| Chemical name |
(<i>E</i>)-2-(1,1-Dicyclohexyl-3-phenylallyl)-5,5-dimethyl-1,3,2-dioxaborinane |
| Formula |
C26 H39 B O2 |
| Calculated formula |
C26 H39 B O2 |
| SMILES |
CC1(C)COB(OC1)C(C1CCCCC1)(C1CCCCC1)/C=C/c1ccccc1 |
| Title of publication |
(<i>E</i>)-2-(1,1-Dicyclohexyl-3-phenylallyl)-5,5-dimethyl-1,3,2-dioxaborinane |
| Authors of publication |
El-Hiti, Gamal A.; Smith, Keith; Elliott, Mark C.; Jones, Dyfyr Heulyn; Kariuki, Benson M. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2013 |
| Journal volume |
69 |
| Journal issue |
9 |
| Pages of publication |
o1403 |
| a |
9.4967 ± 0.0003 Å |
| b |
11.2837 ± 0.0002 Å |
| c |
12.0297 ± 0.0004 Å |
| α |
109.897 ± 0.002° |
| β |
96.388 ± 0.002° |
| γ |
102.048 ± 0.002° |
| Cell volume |
1161.9 ± 0.06 Å3 |
| Cell temperature |
150 ± 2 K |
| Ambient diffraction temperature |
150 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0658 |
| Residual factor for significantly intense reflections |
0.05 |
| Weighted residual factors for significantly intense reflections |
0.1167 |
| Weighted residual factors for all reflections included in the refinement |
0.1275 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.03 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2238484.html