Information card for entry 2238494
| Common name |
[2,5-Dibromo-4-(4-methylbenzoyl)phenyl](4-methylphenyl)methanone |
| Chemical name |
1,4-Dibromo-2,5-di-<i>p</i>-toluoylbenzene |
| Formula |
C22 H16 Br2 O2 |
| Calculated formula |
C22 H16 Br2 O2 |
| SMILES |
O=C(c1cc(Br)c(cc1Br)C(=O)c1ccc(cc1)C)c1ccc(cc1)C |
| Title of publication |
1,4-Dibromo-2,5-di-<i>p</i>-toluoylbenzene |
| Authors of publication |
He, Guang-Ke; Song, Guang-Liang; Chen, Chen; Zhu, Hong-Jun |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2013 |
| Journal volume |
69 |
| Journal issue |
9 |
| Pages of publication |
o1444 |
| a |
9.855 ± 0.002 Å |
| b |
12.064 ± 0.002 Å |
| c |
16.345 ± 0.003 Å |
| α |
90° |
| β |
97.61 ± 0.03° |
| γ |
90° |
| Cell volume |
1926.2 ± 0.6 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.1644 |
| Residual factor for significantly intense reflections |
0.0651 |
| Weighted residual factors for significantly intense reflections |
0.1082 |
| Weighted residual factors for all reflections included in the refinement |
0.1325 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.998 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2238494.html