Information card for entry 2238505
| Common name |
Bis(4-methoxy-3,4-dihydroquinazolin-1-ium) chloranilate |
| Chemical name |
Bis(4-methoxy-3,4-dihydroquinazolin-1-ium) 2,5-dichloro-3,6-dioxocyclohexa-1,4-diene-1,4-diolate |
| Formula |
C24 H22 Cl2 N4 O6 |
| Calculated formula |
C24 H22 Cl2 N4 O6 |
| SMILES |
C1(=C([O-])C(=O)C(=C([O-])C1=O)Cl)Cl.C1=[NH+]c2c(cccc2)C(N1)OC.C1=[NH+]c2c(C(N1)OC)cccc2 |
| Title of publication |
Bis(4-methoxy-3,4-dihydroquinazolin-1-ium) chloranilate |
| Authors of publication |
Gotoh, Kazuma; Ishida, Hiroyuki |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2013 |
| Journal volume |
69 |
| Journal issue |
9 |
| Pages of publication |
o1482 |
| a |
4.9971 ± 0.0004 Å |
| b |
8.6363 ± 0.0004 Å |
| c |
13.5808 ± 0.0009 Å |
| α |
97.869 ± 0.004° |
| β |
91.66 ± 0.006° |
| γ |
100.968 ± 0.005° |
| Cell volume |
569.06 ± 0.07 Å3 |
| Cell temperature |
200 ± 1 K |
| Ambient diffraction temperature |
200 ± 1 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0949 |
| Residual factor for significantly intense reflections |
0.0824 |
| Weighted residual factors for significantly intense reflections |
0.168 |
| Weighted residual factors for all reflections included in the refinement |
0.177 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.843 |
| Diffraction radiation wavelength |
0.71075 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2238505.html